C13H16F2N4S — CID 11522249
5,6-difluoro-2-(2-piperazin-1-ylethylsulfanyl)-1H-benzimidazole (PubChem CID 11522249) has the molecular formula C13H16F2N4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 5,6-difluoro-2-(2-piperazin-1-ylethylsulfanyl)-1H-benzimidazole.
| Compound Name | 5,6-difluoro-2-(2-piperazin-1-ylethylsulfanyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 11522249 |
| Molecular Formula | C13H16F2N4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5,6-difluoro-2-(2-piperazin-1-ylethylsulfanyl)-1H-benzimidazole |
| SMILES | Fc1cc2nc(SCCN3CCNCC3)[nH]c2cc1F |
| InChI | InChI=1S/C13H16F2N4S/c14-9-7-11-12(8-10(9)15)18-13(17-11)20-6-5-19-3-1-16-2-4-19/h7-8,16H,1-6H2,(H,17,18) |
| InChIKey | IFBZDNCOMPETRI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |