C12H16N2OS2 — CID 115223847
2-methyl-6-(methylamino)-4-(2-sulfanylethyl)-1,4-benzothiazin-3-one (PubChem CID 115223847) has the molecular formula C12H16N2OS2 and a molecular weight of 268.41 g/mol. Its IUPAC name is 2-methyl-6-(methylamino)-4-(2-sulfanylethyl)-1,4-benzothiazin-3-one.
| Compound Name | 2-methyl-6-(methylamino)-4-(2-sulfanylethyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 115223847 |
| Molecular Formula | C12H16N2OS2 |
| Molecular Weight | 268.41 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 2-methyl-6-(methylamino)-4-(2-sulfanylethyl)-1,4-benzothiazin-3-one |
| SMILES | CNc1ccc2c(c1)N(CCS)C(=O)C(C)S2 |
| InChI | InChI=1S/C12H16N2OS2/c1-8-12(15)14(5-6-16)10-7-9(13-2)3-4-11(10)17-8/h3-4,7-8,13,16H,5-6H2,1-2H3 |
| InChIKey | OFWHFODRBIUCJM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|