C11H16ClNOS — CID 115223946
2-[(5-chloro-2-methoxy-4-methylphenyl)methylamino]ethanethiol (PubChem CID 115223946) has the molecular formula C11H16ClNOS and a molecular weight of 245.77 g/mol. Its IUPAC name is 2-[(5-chloro-2-methoxy-4-methylphenyl)methylamino]ethanethiol.
| Compound Name | 2-[(5-chloro-2-methoxy-4-methylphenyl)methylamino]ethanethiol |
|---|---|
| PubChem CID | 115223946 |
| Molecular Formula | C11H16ClNOS |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 2-[(5-chloro-2-methoxy-4-methylphenyl)methylamino]ethanethiol |
| SMILES | COc1cc(C)c(Cl)cc1CNCCS |
| InChI | InChI=1S/C11H16ClNOS/c1-8-5-11(14-2)9(6-10(8)12)7-13-3-4-15/h5-6,13,15H,3-4,7H2,1-2H3 |
| InChIKey | CDIPGDBJOJXXMA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|