C15H11Cl2NO2 — CID 11522409
(3,5-dichlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone (PubChem CID 11522409) has the molecular formula C15H11Cl2NO2 and a molecular weight of 308.16 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone.
| Compound Name | (3,5-dichlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone |
|---|---|
| PubChem CID | 11522409 |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | (3,5-dichlorophenyl)-(2,3-dihydro-1,4-benzoxazin-4-yl)methanone |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)N1CCOc2ccccc21 |
| InChI | InChI=1S/C15H11Cl2NO2/c16-11-7-10(8-12(17)9-11)15(19)18-5-6-20-14-4-2-1-3-13(14)18/h1-4,7-9H,5-6H2 |
| InChIKey | JWJYFJORHGJQIW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |