C10H10F2IN — CID 11522432
3-(difluoromethyl)-7-iodo-1,2,3,4-tetrahydroisoquinoline (PubChem CID 11522432) has the molecular formula C10H10F2IN and a molecular weight of 309.10 g/mol. Its IUPAC name is 3-(difluoromethyl)-7-iodo-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 3-(difluoromethyl)-7-iodo-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 11522432 |
| Molecular Formula | C10H10F2IN |
| Molecular Weight | 309.10 g/mol |
| Exact Mass | 308.98 |
| IUPAC Name | 3-(difluoromethyl)-7-iodo-1,2,3,4-tetrahydroisoquinoline |
| SMILES | FC(F)C1Cc2ccc(I)cc2CN1 |
| InChI | InChI=1S/C10H10F2IN/c11-10(12)9-4-6-1-2-8(13)3-7(6)5-14-9/h1-3,9-10,14H,4-5H2 |
| InChIKey | JYYZMJMUWPQGBO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.10 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|