About 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol
3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol (PubChem CID 115225159) has the molecular formula C14H21N3S
and a molecular weight of 263.41 g/mol. Its IUPAC name is 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol.
Molecular Properties
| Compound Name | 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol |
| PubChem CID | 115225159 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol |
| SMILES | Cc1nc2cc(CCNCCCS)ccc2n1C |
| InChI | InChI=1S/C14H21N3S/c1-11-16-13-10-12(4-5-14(13)17(11)2)6-8-15-7-3-9-18/h4-5,10,15,18H,3,6-9H2,1-2H3 |
| InChIKey | QCJJONDLNSTTMX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol?
The IUPAC name of 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol (CID 115225159) is 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol.
What is the SMILES notation for 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol?
The canonical SMILES for 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol is Cc1nc2cc(CCNCCCS)ccc2n1C.
What is the InChIKey of 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol?
The InChIKey is QCJJONDLNSTTMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3S/c1-11-16-13-10-12(4-5-14(13)17(11)2)6-8-15-7-3-9-18/h4-5,10,15,18H,3,6-9H2,1-2H3.
What are the key properties of 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol?
3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol has a molecular weight of 263.41 g/mol, XLogP of 2.33, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol is sourced from PubChem (CID 115225159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).