C14H21N3S — CID 115225159
3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol (PubChem CID 115225159) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol.
| Compound Name | 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol |
|---|---|
| PubChem CID | 115225159 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-[2-(1,2-dimethylbenzimidazol-5-yl)ethylamino]propane-1-thiol |
| SMILES | Cc1nc2cc(CCNCCCS)ccc2n1C |
| InChI | InChI=1S/C14H21N3S/c1-11-16-13-10-12(4-5-14(13)17(11)2)6-8-15-7-3-9-18/h4-5,10,15,18H,3,6-9H2,1-2H3 |
| InChIKey | QCJJONDLNSTTMX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|