C11H18N2O — CID 115225481
N'-(4-methoxy-2,3,6-trimethylphenyl)methanediamine (PubChem CID 115225481) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is N'-(4-methoxy-2,3,6-trimethylphenyl)methanediamine.
| Compound Name | N'-(4-methoxy-2,3,6-trimethylphenyl)methanediamine |
|---|---|
| PubChem CID | 115225481 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | N'-(4-methoxy-2,3,6-trimethylphenyl)methanediamine |
| SMILES | COc1cc(C)c(NCN)c(C)c1C |
| InChI | InChI=1S/C11H18N2O/c1-7-5-10(14-4)8(2)9(3)11(7)13-6-12/h5,13H,6,12H2,1-4H3 |
| InChIKey | BBYDHSXUXNEZSR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|