C20H32O3 — CID 11522629
(3S,4R,4aS,4bS,5R,7R,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-3,4,5-triol (PubChem CID 11522629) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is (3S,4R,4aS,4bS,5R,7R,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-3,4,5-triol.
| Compound Name | (3S,4R,4aS,4bS,5R,7R,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-3,4,5-triol |
|---|---|
| PubChem CID | 11522629 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (3S,4R,4aS,4bS,5R,7R,10aS)-7-ethenyl-1,1,4a,7-tetramethyl-3,4,4b,5,6,9,10,10a-octahydro-2H-phenanthrene-3,4,5-triol |
| SMILES | C=C[C@]1(C)C=C2CC[C@H]3C(C)(C)C[C@H](O)[C@H](O)[C@]3(C)[C@H]2[C@H](O)C1 |
| InChI | InChI=1S/C20H32O3/c1-6-19(4)9-12-7-8-15-18(2,3)10-14(22)17(23)20(15,5)16(12)13(21)11-19/h6,9,13-17,21-23H,1,7-8,10-11H2,2-5H3/t13-,14+,15+,16-,17+,19-,20+/m1/s1 |
| InChIKey | JEXXIARQVKWIJS-ILNMQHDMSA-N |
| XLogP | 3.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|