C17H21BO4S — CID 11522800
ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylate (PubChem CID 11522800) has the molecular formula C17H21BO4S and a molecular weight of 332.23 g/mol. Its IUPAC name is ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 11522800 |
| Molecular Formula | C17H21BO4S |
| Molecular Weight | 332.23 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(B3OC(C)(C)C(C)(C)O3)ccc2s1 |
| InChI | InChI=1S/C17H21BO4S/c1-6-20-15(19)14-10-11-9-12(7-8-13(11)23-14)18-21-16(2,3)17(4,5)22-18/h7-10H,6H2,1-5H3 |
| InChIKey | WSDHXFCLSAEWDG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|