C11H13NOS — CID 115229231
[1-benzothiophen-3-ylmethyl(methyl)amino]methanol (PubChem CID 115229231) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is [1-benzothiophen-3-ylmethyl(methyl)amino]methanol.
| Compound Name | [1-benzothiophen-3-ylmethyl(methyl)amino]methanol |
|---|---|
| PubChem CID | 115229231 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | [1-benzothiophen-3-ylmethyl(methyl)amino]methanol |
| SMILES | CN(CO)Cc1csc2ccccc12 |
| InChI | InChI=1S/C11H13NOS/c1-12(8-13)6-9-7-14-11-5-3-2-4-10(9)11/h2-5,7,13H,6,8H2,1H3 |
| InChIKey | KTAHCPOODSIFRW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|