C12H19NO3 — CID 115229328
[2-(2,5-dimethoxy-4-methylphenyl)ethylamino]methanol (PubChem CID 115229328) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is [2-(2,5-dimethoxy-4-methylphenyl)ethylamino]methanol.
| Compound Name | [2-(2,5-dimethoxy-4-methylphenyl)ethylamino]methanol |
|---|---|
| PubChem CID | 115229328 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | [2-(2,5-dimethoxy-4-methylphenyl)ethylamino]methanol |
| SMILES | COc1cc(CCNCO)c(OC)cc1C |
| InChI | InChI=1S/C12H19NO3/c1-9-6-12(16-3)10(4-5-13-8-14)7-11(9)15-2/h6-7,13-14H,4-5,8H2,1-3H3 |
| InChIKey | MJYYJCVNZMAUAM-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|