About cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol
cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol (PubChem CID 11522934) has the molecular formula C17H20Cl2N2O
and a molecular weight of 339.27 g/mol. Its IUPAC name is cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol.
Molecular Properties
| Compound Name | cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol |
| PubChem CID | 11522934 |
| Molecular Formula | C17H20Cl2N2O |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol |
| SMILES | Cn1ccnc1C(O)(c1ccc(Cl)c(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C17H20Cl2N2O/c1-21-10-9-20-16(21)17(22,12-5-3-2-4-6-12)13-7-8-14(18)15(19)11-13/h7-12,22H,2-6H2,1H3 |
| InChIKey | CIFAYZVVXIYGID-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol?
The IUPAC name of cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol (CID 11522934) is cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol.
What is the SMILES notation for cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol?
The canonical SMILES for cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol is Cn1ccnc1C(O)(c1ccc(Cl)c(Cl)c1)C1CCCCC1.
What is the InChIKey of cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol?
The InChIKey is CIFAYZVVXIYGID-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20Cl2N2O/c1-21-10-9-20-16(21)17(22,12-5-3-2-4-6-12)13-7-8-14(18)15(19)11-13/h7-12,22H,2-6H2,1H3.
What are the key properties of cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol?
cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol has a molecular weight of 339.27 g/mol, XLogP of 4.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(3,4-dichlorophenyl)-(1-methylimidazol-2-yl)methanol is sourced from PubChem (CID 11522934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).