C13H19NO3 — CID 115229600
[[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]methanol (PubChem CID 115229600) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is [[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]methanol.
| Compound Name | [[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]methanol |
|---|---|
| PubChem CID | 115229600 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | [[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-methylpropyl]amino]methanol |
| SMILES | CC(C)(CNCO)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C13H19NO3/c1-13(2,8-14-9-15)10-3-4-11-12(7-10)17-6-5-16-11/h3-4,7,14-15H,5-6,8-9H2,1-2H3 |
| InChIKey | STORVQMWCRDHRE-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|