C12H26N4 — CID 115229945
N,1-dimethyl-N-(piperazin-1-ylmethyl)piperidin-4-amine (PubChem CID 115229945) has the molecular formula C12H26N4 and a molecular weight of 226.37 g/mol. Its IUPAC name is N,1-dimethyl-N-(piperazin-1-ylmethyl)piperidin-4-amine.
| Compound Name | N,1-dimethyl-N-(piperazin-1-ylmethyl)piperidin-4-amine |
|---|---|
| PubChem CID | 115229945 |
| Molecular Formula | C12H26N4 |
| Molecular Weight | 226.37 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | N,1-dimethyl-N-(piperazin-1-ylmethyl)piperidin-4-amine |
| SMILES | CN1CCC(N(C)CN2CCNCC2)CC1 |
| InChI | InChI=1S/C12H26N4/c1-14-7-3-12(4-8-14)15(2)11-16-9-5-13-6-10-16/h12-13H,3-11H2,1-2H3 |
| InChIKey | QCOPPPREZCRDJJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.37 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |