About 1,4-dimethylcyclohexane
1,4-dimethylcyclohexane (PubChem CID 11523) has the molecular formula C8H16
and a molecular weight of 112.22 g/mol. Its IUPAC name is 1,4-dimethylcyclohexane.
Molecular Properties
| Compound Name | 1,4-dimethylcyclohexane |
| PubChem CID | 11523 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | 1,4-dimethylcyclohexane |
| SMILES | CC1CCC(C)CC1 |
| InChI | InChI=1S/C8H16/c1-7-3-5-8(2)6-4-7/h7-8H,3-6H2,1-2H3 |
| InChIKey | QRMPKOFEUHIBNM-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,4-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylcyclohexane?
The IUPAC name of 1,4-dimethylcyclohexane (CID 11523) is 1,4-dimethylcyclohexane.
What is the SMILES notation for 1,4-dimethylcyclohexane?
The canonical SMILES for 1,4-dimethylcyclohexane is CC1CCC(C)CC1.
What is the InChIKey of 1,4-dimethylcyclohexane?
The InChIKey is QRMPKOFEUHIBNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16/c1-7-3-5-8(2)6-4-7/h7-8H,3-6H2,1-2H3.
What are the key properties of 1,4-dimethylcyclohexane?
1,4-dimethylcyclohexane has a molecular weight of 112.22 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylcyclohexane is sourced from PubChem (CID 11523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).