About 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione
1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione (PubChem CID 11523012) has the molecular formula C14H14FNO4S2
and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
| PubChem CID | 11523012 |
| Molecular Formula | C14H14FNO4S2 |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione |
| SMILES | O=C1C(SCCO)=C(SCCO)C(=O)N1c1ccccc1F |
| InChI | InChI=1S/C14H14FNO4S2/c15-9-3-1-2-4-10(9)16-13(19)11(21-7-5-17)12(14(16)20)22-8-6-18/h1-4,17-18H,5-8H2 |
| InChIKey | UJDBHXGAPUFAAM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione?
The IUPAC name of 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione (CID 11523012) is 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione.
What is the SMILES notation for 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione?
The canonical SMILES for 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione is O=C1C(SCCO)=C(SCCO)C(=O)N1c1ccccc1F.
What is the InChIKey of 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione?
The InChIKey is UJDBHXGAPUFAAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FNO4S2/c15-9-3-1-2-4-10(9)16-13(19)11(21-7-5-17)12(14(16)20)22-8-6-18/h1-4,17-18H,5-8H2.
What are the key properties of 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione?
1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione has a molecular weight of 343.40 g/mol, XLogP of 1.36, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)-3,4-bis(2-hydroxyethylsulfanyl)pyrrole-2,5-dione is sourced from PubChem (CID 11523012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).