C12H15ClN2O — CID 115230880
3-[(5-chloro-2-methoxy-3-methylphenyl)methylamino]propanenitrile (PubChem CID 115230880) has the molecular formula C12H15ClN2O and a molecular weight of 238.72 g/mol. Its IUPAC name is 3-[(5-chloro-2-methoxy-3-methylphenyl)methylamino]propanenitrile.
| Compound Name | 3-[(5-chloro-2-methoxy-3-methylphenyl)methylamino]propanenitrile |
|---|---|
| PubChem CID | 115230880 |
| Molecular Formula | C12H15ClN2O |
| Molecular Weight | 238.72 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 3-[(5-chloro-2-methoxy-3-methylphenyl)methylamino]propanenitrile |
| SMILES | COc1c(C)cc(Cl)cc1CNCCC#N |
| InChI | InChI=1S/C12H15ClN2O/c1-9-6-11(13)7-10(12(9)16-2)8-15-5-3-4-14/h6-7,15H,3,5,8H2,1-2H3 |
| InChIKey | NXJNXFUVSUZRJS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.72 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|