C10H13N3 — CID 115231630
4-[methyl(pyridin-2-yl)amino]butanenitrile (PubChem CID 115231630) has the molecular formula C10H13N3 and a molecular weight of 175.24 g/mol. Its IUPAC name is 4-[methyl(pyridin-2-yl)amino]butanenitrile.
| Compound Name | 4-[methyl(pyridin-2-yl)amino]butanenitrile |
|---|---|
| PubChem CID | 115231630 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 4-[methyl(pyridin-2-yl)amino]butanenitrile |
| SMILES | CN(CCCC#N)c1ccccn1 |
| InChI | InChI=1S/C10H13N3/c1-13(9-5-3-7-11)10-6-2-4-8-12-10/h2,4,6,8H,3,5,9H2,1H3 |
| InChIKey | ZJDBJHOYJBFIPJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|