C25H24N2 — CID 11523202
1-[4-(4-isoquinolin-5-ylphenyl)phenyl]-N,N-dimethylethanamine (PubChem CID 11523202) has the molecular formula C25H24N2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-[4-(4-isoquinolin-5-ylphenyl)phenyl]-N,N-dimethylethanamine.
| Compound Name | 1-[4-(4-isoquinolin-5-ylphenyl)phenyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 11523202 |
| Molecular Formula | C25H24N2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | 1-[4-(4-isoquinolin-5-ylphenyl)phenyl]-N,N-dimethylethanamine |
| SMILES | CC(c1ccc(-c2ccc(-c3cccc4cnccc34)cc2)cc1)N(C)C |
| InChI | InChI=1S/C25H24N2/c1-18(27(2)3)19-7-9-20(10-8-19)21-11-13-22(14-12-21)24-6-4-5-23-17-26-16-15-25(23)24/h4-18H,1-3H3 |
| InChIKey | WULWFPTZFYRYBB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |