C14H17N3O2 — CID 115232069
4-[methyl-[2-(2-oxo-3H-1,3-benzoxazol-5-yl)ethyl]amino]butanenitrile (PubChem CID 115232069) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[methyl-[2-(2-oxo-3H-1,3-benzoxazol-5-yl)ethyl]amino]butanenitrile.
| Compound Name | 4-[methyl-[2-(2-oxo-3H-1,3-benzoxazol-5-yl)ethyl]amino]butanenitrile |
|---|---|
| PubChem CID | 115232069 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 4-[methyl-[2-(2-oxo-3H-1,3-benzoxazol-5-yl)ethyl]amino]butanenitrile |
| SMILES | CN(CCCC#N)CCc1ccc2oc(=O)[nH]c2c1 |
| InChI | InChI=1S/C14H17N3O2/c1-17(8-3-2-7-15)9-6-11-4-5-13-12(10-11)16-14(18)19-13/h4-5,10H,2-3,6,8-9H2,1H3,(H,16,18) |
| InChIKey | DXEOEPHLSLBGIP-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 73.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|