About 8-cyclohexyl-2,6-diphenyl-7H-purine
8-cyclohexyl-2,6-diphenyl-7H-purine (PubChem CID 11523232) has the molecular formula C23H22N4
and a molecular weight of 354.46 g/mol. Its IUPAC name is 8-cyclohexyl-2,6-diphenyl-7H-purine.
Molecular Properties
| Compound Name | 8-cyclohexyl-2,6-diphenyl-7H-purine |
| PubChem CID | 11523232 |
| Molecular Formula | C23H22N4 |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 8-cyclohexyl-2,6-diphenyl-7H-purine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)c3[nH]c(C4CCCCC4)nc3n2)cc1 |
| InChI | InChI=1S/C23H22N4/c1-4-10-16(11-5-1)19-20-23(26-21(24-19)17-12-6-2-7-13-17)27-22(25-20)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2,(H,24,25,26,27) |
| InChIKey | IGJKVZBNIOTBGI-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 8-cyclohexyl-2,6-diphenyl-7H-purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-cyclohexyl-2,6-diphenyl-7H-purine?
The IUPAC name of 8-cyclohexyl-2,6-diphenyl-7H-purine (CID 11523232) is 8-cyclohexyl-2,6-diphenyl-7H-purine.
What is the SMILES notation for 8-cyclohexyl-2,6-diphenyl-7H-purine?
The canonical SMILES for 8-cyclohexyl-2,6-diphenyl-7H-purine is c1ccc(-c2nc(-c3ccccc3)c3[nH]c(C4CCCCC4)nc3n2)cc1.
What is the InChIKey of 8-cyclohexyl-2,6-diphenyl-7H-purine?
The InChIKey is IGJKVZBNIOTBGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4/c1-4-10-16(11-5-1)19-20-23(26-21(24-19)17-12-6-2-7-13-17)27-22(25-20)18-14-8-3-9-15-18/h1-2,4-7,10-13,18H,3,8-9,14-15H2,(H,24,25,26,27).
What are the key properties of 8-cyclohexyl-2,6-diphenyl-7H-purine?
8-cyclohexyl-2,6-diphenyl-7H-purine has a molecular weight of 354.46 g/mol, XLogP of 5.73, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-cyclohexyl-2,6-diphenyl-7H-purine is sourced from PubChem (CID 11523232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).