C19H20ClN3S — CID 11523308
7-chloro-3-[2-(4-methylpiperazin-1-yl)phenyl]sulfanyl-1H-indole (PubChem CID 11523308) has the molecular formula C19H20ClN3S and a molecular weight of 357.91 g/mol. Its IUPAC name is 7-chloro-3-[2-(4-methylpiperazin-1-yl)phenyl]sulfanyl-1H-indole.
| Compound Name | 7-chloro-3-[2-(4-methylpiperazin-1-yl)phenyl]sulfanyl-1H-indole |
|---|---|
| PubChem CID | 11523308 |
| Molecular Formula | C19H20ClN3S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | 7-chloro-3-[2-(4-methylpiperazin-1-yl)phenyl]sulfanyl-1H-indole |
| SMILES | CN1CCN(c2ccccc2Sc2c[nH]c3c(Cl)cccc23)CC1 |
| InChI | InChI=1S/C19H20ClN3S/c1-22-9-11-23(12-10-22)16-7-2-3-8-17(16)24-18-13-21-19-14(18)5-4-6-15(19)20/h2-8,13,21H,9-12H2,1H3 |
| InChIKey | GNPGAUKZRYTNEE-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 22.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |