C16H25NO2 — CID 115233613
methyl 2,2-dimethyl-3-(N-methyl-4-propan-2-ylanilino)propanoate (PubChem CID 115233613) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is methyl 2,2-dimethyl-3-(N-methyl-4-propan-2-ylanilino)propanoate.
| Compound Name | methyl 2,2-dimethyl-3-(N-methyl-4-propan-2-ylanilino)propanoate |
|---|---|
| PubChem CID | 115233613 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | methyl 2,2-dimethyl-3-(N-methyl-4-propan-2-ylanilino)propanoate |
| SMILES | COC(=O)C(C)(C)CN(C)c1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C16H25NO2/c1-12(2)13-7-9-14(10-8-13)17(5)11-16(3,4)15(18)19-6/h7-10,12H,11H2,1-6H3 |
| InChIKey | HAMYQEBMNVEKCJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|