C15H16N2 — CID 115233857
2,2-dimethyl-3-(naphthalen-1-ylamino)propanenitrile (PubChem CID 115233857) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2,2-dimethyl-3-(naphthalen-1-ylamino)propanenitrile.
| Compound Name | 2,2-dimethyl-3-(naphthalen-1-ylamino)propanenitrile |
|---|---|
| PubChem CID | 115233857 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2,2-dimethyl-3-(naphthalen-1-ylamino)propanenitrile |
| SMILES | CC(C)(C#N)CNc1cccc2ccccc12 |
| InChI | InChI=1S/C15H16N2/c1-15(2,10-16)11-17-14-9-5-7-12-6-3-4-8-13(12)14/h3-9,17H,11H2,1-2H3 |
| InChIKey | HIONBKNIAUUNAZ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |