C13H10IN5 — CID 11523399
15-iodo-5-methyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene (PubChem CID 11523399) has the molecular formula C13H10IN5 and a molecular weight of 363.16 g/mol. Its IUPAC name is 15-iodo-5-methyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene.
| Compound Name | 15-iodo-5-methyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
|---|---|
| PubChem CID | 11523399 |
| Molecular Formula | C13H10IN5 |
| Molecular Weight | 363.16 g/mol |
| Exact Mass | 363.00 |
| IUPAC Name | 15-iodo-5-methyl-2,4,8,9,11-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,9,11,14,16-heptaene |
| SMILES | Cc1ncn2c1Cn1ncnc1-c1cc(I)ccc1-2 |
| InChI | InChI=1S/C13H10IN5/c1-8-12-5-19-13(15-6-17-19)10-4-9(14)2-3-11(10)18(12)7-16-8/h2-4,6-7H,5H2,1H3 |
| InChIKey | HFRRPIOHPBZYIO-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.16 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|