C18H21NO5S — CID 11523408
(2R,3'aR,4S,5R,6'aR)-3'a-methyl-2-phenyl-4-propan-2-yl-2'-sulfanylidenespiro[1,3-dioxane-5,6'-5,6a-dihydro-[1,3]dioxolo[4,5-c]pyrrole]-4'-one (PubChem CID 11523408) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is (2R,3'aR,4S,5R,6'aR)-3'a-methyl-2-phenyl-4-propan-2-yl-2'-sulfanylidenespiro[1,3-dioxane-5,6'-5,6a-dihydro-[1,3]dioxolo[4,5-c]pyrrole]-4'-one.
| Compound Name | (2R,3'aR,4S,5R,6'aR)-3'a-methyl-2-phenyl-4-propan-2-yl-2'-sulfanylidenespiro[1,3-dioxane-5,6'-5,6a-dihydro-[1,3]dioxolo[4,5-c]pyrrole]-4'-one |
|---|---|
| PubChem CID | 11523408 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (2R,3'aR,4S,5R,6'aR)-3'a-methyl-2-phenyl-4-propan-2-yl-2'-sulfanylidenespiro[1,3-dioxane-5,6'-5,6a-dihydro-[1,3]dioxolo[4,5-c]pyrrole]-4'-one |
| SMILES | CC(C)[C@@H]1O[C@H](c2ccccc2)OC[C@@]12NC(=O)[C@]1(C)OC(=S)O[C@H]21 |
| InChI | InChI=1S/C18H21NO5S/c1-10(2)12-18(9-21-13(22-12)11-7-5-4-6-8-11)14-17(3,15(20)19-18)24-16(25)23-14/h4-8,10,12-14H,9H2,1-3H3,(H,19,20)/t12-,13+,14-,17+,18+/m0/s1 |
| InChIKey | ZOXKUSRLJDXZHA-IZOOLLGQSA-N |
| XLogP | 2.08 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|