About ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate
ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate (PubChem CID 11523476) has the molecular formula C19H21F3N2O2
and a molecular weight of 366.38 g/mol. Its IUPAC name is ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate |
| PubChem CID | 11523476 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1c(C)cc(CNc2ccc(C(F)(F)F)cc2)cc1C |
| InChI | InChI=1S/C19H21F3N2O2/c1-4-26-18(25)24-17-12(2)9-14(10-13(17)3)11-23-16-7-5-15(6-8-16)19(20,21)22/h5-10,23H,4,11H2,1-3H3,(H,24,25) |
| InChIKey | IECMFWSPQDIVPW-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate?
The IUPAC name of ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate (CID 11523476) is ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate.
What is the SMILES notation for ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate?
The canonical SMILES for ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate is CCOC(=O)Nc1c(C)cc(CNc2ccc(C(F)(F)F)cc2)cc1C.
What is the InChIKey of ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate?
The InChIKey is IECMFWSPQDIVPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21F3N2O2/c1-4-26-18(25)24-17-12(2)9-14(10-13(17)3)11-23-16-7-5-15(6-8-16)19(20,21)22/h5-10,23H,4,11H2,1-3H3,(H,24,25).
What are the key properties of ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate?
ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate has a molecular weight of 366.38 g/mol, XLogP of 5.50, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2,6-dimethyl-4-[[4-(trifluoromethyl)anilino]methyl]phenyl]carbamate is sourced from PubChem (CID 11523476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).