About N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide
N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide (PubChem CID 11523639) has the molecular formula C17H13Cl2N5O
and a molecular weight of 374.23 g/mol. Its IUPAC name is N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide |
| PubChem CID | 11523639 |
| Molecular Formula | C17H13Cl2N5O |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1cccc(-c2cncc(Nc3cc(Cl)nc(Cl)c3)n2)c1 |
| InChI | InChI=1S/C17H13Cl2N5O/c1-10(25)21-12-4-2-3-11(5-12)14-8-20-9-17(23-14)22-13-6-15(18)24-16(19)7-13/h2-9H,1H3,(H,21,25)(H,22,23,24) |
| InChIKey | HBZLYXODYAMSLH-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide?
The IUPAC name of N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide (CID 11523639) is N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide.
What is the SMILES notation for N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide?
The canonical SMILES for N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide is CC(=O)Nc1cccc(-c2cncc(Nc3cc(Cl)nc(Cl)c3)n2)c1.
What is the InChIKey of N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide?
The InChIKey is HBZLYXODYAMSLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2N5O/c1-10(25)21-12-4-2-3-11(5-12)14-8-20-9-17(23-14)22-13-6-15(18)24-16(19)7-13/h2-9H,1H3,(H,21,25)(H,22,23,24).
What are the key properties of N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide?
N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide has a molecular weight of 374.23 g/mol, XLogP of 4.55, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[6-[(2,6-dichloro-4-pyridinyl)amino]pyrazin-2-yl]phenyl]acetamide is sourced from PubChem (CID 11523639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).