About 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide
1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide (PubChem CID 11523680) has the molecular formula C18H24N4O5
and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide.
Molecular Properties
| Compound Name | 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide |
| PubChem CID | 11523680 |
| Molecular Formula | C18H24N4O5 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide |
| SMILES | CCCc1nn(C)c(C(N)=O)c1NC(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C18H24N4O5/c1-6-7-11-14(15(17(19)23)22(2)21-11)20-18(24)10-8-12(25-3)16(27-5)13(9-10)26-4/h8-9H,6-7H2,1-5H3,(H2,19,23)(H,20,24) |
| InChIKey | YIUJSTZMOXFARH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide?
The IUPAC name of 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide (CID 11523680) is 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide.
What is the SMILES notation for 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide?
The canonical SMILES for 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide is CCCc1nn(C)c(C(N)=O)c1NC(=O)c1cc(OC)c(OC)c(OC)c1.
What is the InChIKey of 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide?
The InChIKey is YIUJSTZMOXFARH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24N4O5/c1-6-7-11-14(15(17(19)23)22(2)21-11)20-18(24)10-8-12(25-3)16(27-5)13(9-10)26-4/h8-9H,6-7H2,1-5H3,(H2,19,23)(H,20,24).
What are the key properties of 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide?
1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide has a molecular weight of 376.41 g/mol, XLogP of 1.75, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-propyl-4-[(3,4,5-trimethoxybenzoyl)amino]pyrazole-5-carboxamide is sourced from PubChem (CID 11523680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).