C13H17NO2S — CID 115236909
(E)-4-(4-propan-2-ylsulfanylanilino)but-2-enoic acid (PubChem CID 115236909) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is (E)-4-(4-propan-2-ylsulfanylanilino)but-2-enoic acid.
| Compound Name | (E)-4-(4-propan-2-ylsulfanylanilino)but-2-enoic acid |
|---|---|
| PubChem CID | 115236909 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | (E)-4-(4-propan-2-ylsulfanylanilino)but-2-enoic acid |
| SMILES | CC(C)Sc1ccc(NC/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C13H17NO2S/c1-10(2)17-12-7-5-11(6-8-12)14-9-3-4-13(15)16/h3-8,10,14H,9H2,1-2H3,(H,15,16)/b4-3+ |
| InChIKey | BJIVPJOIDCUBPV-ONEGZZNKSA-N |
| XLogP | 3.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|