C13H16FNO2 — CID 115237336
(E)-4-[2-(4-fluorophenyl)ethyl-methylamino]but-2-enoic acid (PubChem CID 115237336) has the molecular formula C13H16FNO2 and a molecular weight of 237.27 g/mol. Its IUPAC name is (E)-4-[2-(4-fluorophenyl)ethyl-methylamino]but-2-enoic acid.
| Compound Name | (E)-4-[2-(4-fluorophenyl)ethyl-methylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 115237336 |
| Molecular Formula | C13H16FNO2 |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.12 |
| IUPAC Name | (E)-4-[2-(4-fluorophenyl)ethyl-methylamino]but-2-enoic acid |
| SMILES | CN(C/C=C/C(=O)O)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C13H16FNO2/c1-15(9-2-3-13(16)17)10-8-11-4-6-12(14)7-5-11/h2-7H,8-10H2,1H3,(H,16,17)/b3-2+ |
| InChIKey | OQZHPVQEKWJVPX-NSCUHMNNSA-N |
| XLogP | 1.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|