C14H21FN2O — CID 115238118
2-(4-fluoro-3-methylphenyl)-N-(morpholin-3-ylmethyl)ethanamine (PubChem CID 115238118) has the molecular formula C14H21FN2O and a molecular weight of 252.33 g/mol. Its IUPAC name is 2-(4-fluoro-3-methylphenyl)-N-(morpholin-3-ylmethyl)ethanamine.
| Compound Name | 2-(4-fluoro-3-methylphenyl)-N-(morpholin-3-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 115238118 |
| Molecular Formula | C14H21FN2O |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 2-(4-fluoro-3-methylphenyl)-N-(morpholin-3-ylmethyl)ethanamine |
| SMILES | Cc1cc(CCNCC2COCCN2)ccc1F |
| InChI | InChI=1S/C14H21FN2O/c1-11-8-12(2-3-14(11)15)4-5-16-9-13-10-18-7-6-17-13/h2-3,8,13,16-17H,4-7,9-10H2,1H3 |
| InChIKey | KHOUCGIPXPNQHZ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|