C20H31N3O4 — CID 11523815
(2S)-2-[[4-[2-(diethylamino)ethylcarbamoyl]benzoyl]amino]-4-methylpentanoic acid (PubChem CID 11523815) has the molecular formula C20H31N3O4 and a molecular weight of 377.49 g/mol. Its IUPAC name is (2S)-2-[[4-[2-(diethylamino)ethylcarbamoyl]benzoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[4-[2-(diethylamino)ethylcarbamoyl]benzoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 11523815 |
| Molecular Formula | C20H31N3O4 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.23 |
| IUPAC Name | (2S)-2-[[4-[2-(diethylamino)ethylcarbamoyl]benzoyl]amino]-4-methylpentanoic acid |
| SMILES | CCN(CC)CCNC(=O)c1ccc(C(=O)N[C@@H](CC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C20H31N3O4/c1-5-23(6-2)12-11-21-18(24)15-7-9-16(10-8-15)19(25)22-17(20(26)27)13-14(3)4/h7-10,14,17H,5-6,11-13H2,1-4H3,(H,21,24)(H,22,25)(H,26,27)/t17-/m0/s1 |
| InChIKey | JNXNFYRXVCJEOR-KRWDZBQOSA-N |
| XLogP | 1.99 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |