C14H21FN2O2 — CID 115239190
N-[(3-fluoro-4-methoxyphenyl)methyl]-2-morpholin-2-ylethanamine (PubChem CID 115239190) has the molecular formula C14H21FN2O2 and a molecular weight of 268.33 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-2-morpholin-2-ylethanamine.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-2-morpholin-2-ylethanamine |
|---|---|
| PubChem CID | 115239190 |
| Molecular Formula | C14H21FN2O2 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-2-morpholin-2-ylethanamine |
| SMILES | COc1ccc(CNCCC2CNCCO2)cc1F |
| InChI | InChI=1S/C14H21FN2O2/c1-18-14-3-2-11(8-13(14)15)9-16-5-4-12-10-17-6-7-19-12/h2-3,8,12,16-17H,4-7,9-10H2,1H3 |
| InChIKey | JXAJNJPCJWJUGQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|