C16H15ClN4O4S — CID 11524055
8-amino-1-chloro-N-(diaminomethylidene)-10-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide (PubChem CID 11524055) has the molecular formula C16H15ClN4O4S and a molecular weight of 394.84 g/mol. Its IUPAC name is 8-amino-1-chloro-N-(diaminomethylidene)-10-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide.
| Compound Name | 8-amino-1-chloro-N-(diaminomethylidene)-10-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
|---|---|
| PubChem CID | 11524055 |
| Molecular Formula | C16H15ClN4O4S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 8-amino-1-chloro-N-(diaminomethylidene)-10-methyl-5,5-dioxo-6H-benzo[b][1,5]benzoxathiepine-3-carboxamide |
| SMILES | Cc1cc(N)cc2c1Oc1c(Cl)cc(C(=O)N=C(N)N)cc1S(=O)(=O)C2 |
| InChI | InChI=1S/C16H15ClN4O4S/c1-7-2-10(18)3-9-6-26(23,24)12-5-8(15(22)21-16(19)20)4-11(17)14(12)25-13(7)9/h2-5H,6,18H2,1H3,(H4,19,20,21,22) |
| InChIKey | GBUINGGOYUIJSM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|