C12H16F2N2O2 — CID 115241759
3-amino-4-[(2,4-difluorophenyl)methyl-methylamino]butanoic acid (PubChem CID 115241759) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 3-amino-4-[(2,4-difluorophenyl)methyl-methylamino]butanoic acid.
| Compound Name | 3-amino-4-[(2,4-difluorophenyl)methyl-methylamino]butanoic acid |
|---|---|
| PubChem CID | 115241759 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 3-amino-4-[(2,4-difluorophenyl)methyl-methylamino]butanoic acid |
| SMILES | CN(Cc1ccc(F)cc1F)CC(N)CC(=O)O |
| InChI | InChI=1S/C12H16F2N2O2/c1-16(7-10(15)5-12(17)18)6-8-2-3-9(13)4-11(8)14/h2-4,10H,5-7,15H2,1H3,(H,17,18) |
| InChIKey | BBOMRMOTBRYZGJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |