C24H36O3S — CID 11524255
(1S,5S)-5-nonyl-1-(2,4,6-trimethylphenyl)sulfonylbicyclo[3.1.0]hexan-2-one (PubChem CID 11524255) has the molecular formula C24H36O3S and a molecular weight of 404.62 g/mol. Its IUPAC name is (1S,5S)-5-nonyl-1-(2,4,6-trimethylphenyl)sulfonylbicyclo[3.1.0]hexan-2-one.
| Compound Name | (1S,5S)-5-nonyl-1-(2,4,6-trimethylphenyl)sulfonylbicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 11524255 |
| Molecular Formula | C24H36O3S |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.24 |
| IUPAC Name | (1S,5S)-5-nonyl-1-(2,4,6-trimethylphenyl)sulfonylbicyclo[3.1.0]hexan-2-one |
| SMILES | CCCCCCCCC[C@@]12CCC(=O)[C@]1(S(=O)(=O)c1c(C)cc(C)cc1C)C2 |
| InChI | InChI=1S/C24H36O3S/c1-5-6-7-8-9-10-11-13-23-14-12-21(25)24(23,17-23)28(26,27)22-19(3)15-18(2)16-20(22)4/h15-16H,5-14,17H2,1-4H3/t23-,24+/m0/s1 |
| InChIKey | GKKOGFXSLVPCDW-BJKOFHAPSA-N |
| XLogP | 6.02 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|