C13H22N2 — CID 115242689
1-[[(2-cyclobutyl-2-methylpropyl)amino]methyl]cyclopropane-1-carbonitrile (PubChem CID 115242689) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-[[(2-cyclobutyl-2-methylpropyl)amino]methyl]cyclopropane-1-carbonitrile.
| Compound Name | 1-[[(2-cyclobutyl-2-methylpropyl)amino]methyl]cyclopropane-1-carbonitrile |
|---|---|
| PubChem CID | 115242689 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-[[(2-cyclobutyl-2-methylpropyl)amino]methyl]cyclopropane-1-carbonitrile |
| SMILES | CC(C)(CNCC1(C#N)CC1)C1CCC1 |
| InChI | InChI=1S/C13H22N2/c1-12(2,11-4-3-5-11)9-15-10-13(8-14)6-7-13/h11,15H,3-7,9-10H2,1-2H3 |
| InChIKey | KFFZOBSVSYBLAO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |