C10H17NO3 — CID 115242782
1-[(oxan-4-ylamino)methyl]cyclopropane-1-carboxylic acid (PubChem CID 115242782) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 1-[(oxan-4-ylamino)methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(oxan-4-ylamino)methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 115242782 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 1-[(oxan-4-ylamino)methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNC2CCOCC2)CC1 |
| InChI | InChI=1S/C10H17NO3/c12-9(13)10(3-4-10)7-11-8-1-5-14-6-2-8/h8,11H,1-7H2,(H,12,13) |
| InChIKey | UITDKFKENIOTGO-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |