C25H26O5 — CID 11524286
(2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-2-naphthalen-2-yl-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine (PubChem CID 11524286) has the molecular formula C25H26O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is (2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-2-naphthalen-2-yl-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine.
| Compound Name | (2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-2-naphthalen-2-yl-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
|---|---|
| PubChem CID | 11524286 |
| Molecular Formula | C25H26O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | (2R,4aR,6S,7S,8R,8aR)-7,8-dimethoxy-2-naphthalen-2-yl-6-phenyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine |
| SMILES | CO[C@@H]1[C@@H](OC)[C@H](c2ccccc2)O[C@@H]2CO[C@@H](c3ccc4ccccc4c3)O[C@@H]12 |
| InChI | InChI=1S/C25H26O5/c1-26-23-21(17-9-4-3-5-10-17)29-20-15-28-25(30-22(20)24(23)27-2)19-13-12-16-8-6-7-11-18(16)14-19/h3-14,20-25H,15H2,1-2H3/t20-,21+,22-,23+,24+,25-/m1/s1 |
| InChIKey | AVLPLHDSANEDSO-PROFCWERSA-N |
| XLogP | 4.42 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |