C12H14BrNO2 — CID 115242975
1-[[(2-bromophenyl)methylamino]methyl]cyclopropane-1-carboxylic acid (PubChem CID 115242975) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is 1-[[(2-bromophenyl)methylamino]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[(2-bromophenyl)methylamino]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 115242975 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 1-[[(2-bromophenyl)methylamino]methyl]cyclopropane-1-carboxylic acid |
| SMILES | O=C(O)C1(CNCc2ccccc2Br)CC1 |
| InChI | InChI=1S/C12H14BrNO2/c13-10-4-2-1-3-9(10)7-14-8-12(5-6-12)11(15)16/h1-4,14H,5-8H2,(H,15,16) |
| InChIKey | XJTYPZMZGIFNDS-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |