C22H36O5Si — CID 11524351
(3R)-3-[(3aR,5S,6R,6aR)-6-[(Z)-but-2-enyl]-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-1-trimethylsilylhept-6-en-1-yn-3-ol (PubChem CID 11524351) has the molecular formula C22H36O5Si and a molecular weight of 408.61 g/mol. Its IUPAC name is (3R)-3-[(3aR,5S,6R,6aR)-6-[(Z)-but-2-enyl]-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-1-trimethylsilylhept-6-en-1-yn-3-ol.
| Compound Name | (3R)-3-[(3aR,5S,6R,6aR)-6-[(Z)-but-2-enyl]-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-1-trimethylsilylhept-6-en-1-yn-3-ol |
|---|---|
| PubChem CID | 11524351 |
| Molecular Formula | C22H36O5Si |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | (3R)-3-[(3aR,5S,6R,6aR)-6-[(Z)-but-2-enyl]-6-methoxy-2,2-dimethyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]-1-trimethylsilylhept-6-en-1-yn-3-ol |
| SMILES | C=CCC[C@@](O)(C#C[Si](C)(C)C)[C@@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@]1(C/C=C\C)OC |
| InChI | InChI=1S/C22H36O5Si/c1-9-11-13-21(23,15-16-28(6,7)8)19-22(24-5,14-12-10-2)17-18(25-19)27-20(3,4)26-17/h9-10,12,17-19,23H,1,11,13-14H2,2-8H3/b12-10-/t17-,18+,19-,21+,22-/m0/s1 |
| InChIKey | BJKANFPVGKUJLB-CGBFBFRPSA-N |
| XLogP | 3.79 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|