C14H18N2O3 — CID 115243683
5-[2-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethyl]-3H-1,3-benzoxazol-2-one (PubChem CID 115243683) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 5-[2-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-[2-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115243683 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5-[2-[[1-(hydroxymethyl)cyclopropyl]methylamino]ethyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2cc(CCNCC3(CO)CC3)ccc2o1 |
| InChI | InChI=1S/C14H18N2O3/c17-9-14(4-5-14)8-15-6-3-10-1-2-12-11(7-10)16-13(18)19-12/h1-2,7,15,17H,3-6,8-9H2,(H,16,18) |
| InChIKey | WUIJUUQHCWIKAL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|