C16H26N2 — CID 115244289
N-[[1-(aminomethyl)cyclopropyl]methyl]-2-(4-propylphenyl)ethanamine (PubChem CID 115244289) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is N-[[1-(aminomethyl)cyclopropyl]methyl]-2-(4-propylphenyl)ethanamine.
| Compound Name | N-[[1-(aminomethyl)cyclopropyl]methyl]-2-(4-propylphenyl)ethanamine |
|---|---|
| PubChem CID | 115244289 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N-[[1-(aminomethyl)cyclopropyl]methyl]-2-(4-propylphenyl)ethanamine |
| SMILES | CCCc1ccc(CCNCC2(CN)CC2)cc1 |
| InChI | InChI=1S/C16H26N2/c1-2-3-14-4-6-15(7-5-14)8-11-18-13-16(12-17)9-10-16/h4-7,18H,2-3,8-13,17H2,1H3 |
| InChIKey | AATOCJIFHUYPDP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|