C24H32O6 — CID 11524511
(1R,2R,3S,4S,6R)-4-[5-[(4-ethylphenyl)methyl]-2,4-dimethoxyphenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol (PubChem CID 11524511) has the molecular formula C24H32O6 and a molecular weight of 416.51 g/mol. Its IUPAC name is (1R,2R,3S,4S,6R)-4-[5-[(4-ethylphenyl)methyl]-2,4-dimethoxyphenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol.
| Compound Name | (1R,2R,3S,4S,6R)-4-[5-[(4-ethylphenyl)methyl]-2,4-dimethoxyphenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 11524511 |
| Molecular Formula | C24H32O6 |
| Molecular Weight | 416.51 g/mol |
| Exact Mass | 416.22 |
| IUPAC Name | (1R,2R,3S,4S,6R)-4-[5-[(4-ethylphenyl)methyl]-2,4-dimethoxyphenyl]-6-(hydroxymethyl)cyclohexane-1,2,3-triol |
| SMILES | CCc1ccc(Cc2cc([C@@H]3C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C24H32O6/c1-4-14-5-7-15(8-6-14)9-16-10-18(21(30-3)12-20(16)29-2)19-11-17(13-25)22(26)24(28)23(19)27/h5-8,10,12,17,19,22-28H,4,9,11,13H2,1-3H3/t17-,19+,22-,23+,24+/m1/s1 |
| InChIKey | WKVPTVMGLXDFTB-OTBWLPETSA-N |
| XLogP | 2.04 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.51 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |