C15H20N2O2 — CID 115245139
1-[(2,4-dimethoxy-N-methylanilino)methyl]cyclobutane-1-carbonitrile (PubChem CID 115245139) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-[(2,4-dimethoxy-N-methylanilino)methyl]cyclobutane-1-carbonitrile.
| Compound Name | 1-[(2,4-dimethoxy-N-methylanilino)methyl]cyclobutane-1-carbonitrile |
|---|---|
| PubChem CID | 115245139 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-[(2,4-dimethoxy-N-methylanilino)methyl]cyclobutane-1-carbonitrile |
| SMILES | COc1ccc(N(C)CC2(C#N)CCC2)c(OC)c1 |
| InChI | InChI=1S/C15H20N2O2/c1-17(11-15(10-16)7-4-8-15)13-6-5-12(18-2)9-14(13)19-3/h5-6,9H,4,7-8,11H2,1-3H3 |
| InChIKey | MKKIXDQXLGUUHS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|