C11H14BrNO2S — CID 115246460
1-[[(4-bromothiophen-2-yl)-methylamino]methyl]cyclobutane-1-carboxylic acid (PubChem CID 115246460) has the molecular formula C11H14BrNO2S and a molecular weight of 304.21 g/mol. Its IUPAC name is 1-[[(4-bromothiophen-2-yl)-methylamino]methyl]cyclobutane-1-carboxylic acid.
| Compound Name | 1-[[(4-bromothiophen-2-yl)-methylamino]methyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 115246460 |
| Molecular Formula | C11H14BrNO2S |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 302.99 |
| IUPAC Name | 1-[[(4-bromothiophen-2-yl)-methylamino]methyl]cyclobutane-1-carboxylic acid |
| SMILES | CN(CC1(C(=O)O)CCC1)c1cc(Br)cs1 |
| InChI | InChI=1S/C11H14BrNO2S/c1-13(9-5-8(12)6-16-9)7-11(10(14)15)3-2-4-11/h5-6H,2-4,7H2,1H3,(H,14,15) |
| InChIKey | BCHUANVHQSJNNS-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |