C19H11F4NO4S — CID 11524688
3-[[2,3,5,6-tetrafluoro-4-(2-methoxyphenyl)phenyl]carbamoyl]thiophene-2-carboxylic acid (PubChem CID 11524688) has the molecular formula C19H11F4NO4S and a molecular weight of 425.36 g/mol. Its IUPAC name is 3-[[2,3,5,6-tetrafluoro-4-(2-methoxyphenyl)phenyl]carbamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[2,3,5,6-tetrafluoro-4-(2-methoxyphenyl)phenyl]carbamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 11524688 |
| Molecular Formula | C19H11F4NO4S |
| Molecular Weight | 425.36 g/mol |
| Exact Mass | 425.03 |
| IUPAC Name | 3-[[2,3,5,6-tetrafluoro-4-(2-methoxyphenyl)phenyl]carbamoyl]thiophene-2-carboxylic acid |
| SMILES | COc1ccccc1-c1c(F)c(F)c(NC(=O)c2ccsc2C(=O)O)c(F)c1F |
| InChI | InChI=1S/C19H11F4NO4S/c1-28-10-5-3-2-4-8(10)11-12(20)14(22)16(15(23)13(11)21)24-18(25)9-6-7-29-17(9)19(26)27/h2-7H,1H3,(H,24,25)(H,26,27) |
| InChIKey | SLAAWWZPXRJKGO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.36 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|