About (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate
(2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate (PubChem CID 11524837) has the molecular formula C21H24N2O6S
and a molecular weight of 432.50 g/mol. Its IUPAC name is (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate.
Molecular Properties
| Compound Name | (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate |
| PubChem CID | 11524837 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate |
| SMILES | COc1cccc(OS(=O)(=O)c2cc(N3CCN[C@H](C)C3)c3occc3c2)c1OC |
| InChI | InChI=1S/C21H24N2O6S/c1-14-13-23(9-8-22-14)17-12-16(11-15-7-10-28-20(15)17)30(24,25)29-19-6-4-5-18(26-2)21(19)27-3/h4-7,10-12,14,22H,8-9,13H2,1-3H3/t14-/m1/s1 |
| InChIKey | LINNEMKNTQEDEJ-CQSZACIVSA-N |
| XLogP | 3.02 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate?
The IUPAC name of (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate (CID 11524837) is (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate.
What is the SMILES notation for (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate?
The canonical SMILES for (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate is COc1cccc(OS(=O)(=O)c2cc(N3CCN[C@H](C)C3)c3occc3c2)c1OC.
What is the InChIKey of (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate?
The InChIKey is LINNEMKNTQEDEJ-CQSZACIVSA-N. The full InChI is InChI=1S/C21H24N2O6S/c1-14-13-23(9-8-22-14)17-12-16(11-15-7-10-28-20(15)17)30(24,25)29-19-6-4-5-18(26-2)21(19)27-3/h4-7,10-12,14,22H,8-9,13H2,1-3H3/t14-/m1/s1.
What are the key properties of (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate?
(2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate has a molecular weight of 432.50 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3-dimethoxyphenyl) 7-[(3R)-3-methylpiperazin-1-yl]-1-benzofuran-5-sulfonate is sourced from PubChem (CID 11524837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).