C22H37N3O6 — CID 11524971
tert-butyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(3S,5S)-3-(2-methylprop-2-enyl)-2-oxo-5-propan-2-ylmorpholin-4-yl]methylidene]carbamate (PubChem CID 11524971) has the molecular formula C22H37N3O6 and a molecular weight of 439.55 g/mol. Its IUPAC name is tert-butyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(3S,5S)-3-(2-methylprop-2-enyl)-2-oxo-5-propan-2-ylmorpholin-4-yl]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(3S,5S)-3-(2-methylprop-2-enyl)-2-oxo-5-propan-2-ylmorpholin-4-yl]methylidene]carbamate |
|---|---|
| PubChem CID | 11524971 |
| Molecular Formula | C22H37N3O6 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | tert-butyl (NE)-N-[[(2-methylpropan-2-yl)oxycarbonylamino]-[(3S,5S)-3-(2-methylprop-2-enyl)-2-oxo-5-propan-2-ylmorpholin-4-yl]methylidene]carbamate |
| SMILES | C=C(C)C[C@H]1C(=O)OC[C@H](C(C)C)N1/C(=N/C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37N3O6/c1-13(2)11-15-17(26)29-12-16(14(3)4)25(15)18(23-19(27)30-21(5,6)7)24-20(28)31-22(8,9)10/h14-16H,1,11-12H2,2-10H3,(H,23,24,27,28)/t15-,16+/m0/s1 |
| InChIKey | LXBLRFUJQLFZQR-JKSUJKDBSA-N |
| XLogP | 4.02 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|